C15H16ClNO — CID 53362205
7-chloro-2,2-dimethyl-1,3,4,10-tetrahydroacridin-9-one (PubChem CID 53362205) has the molecular formula C15H16ClNO and a molecular weight of 261.75 g/mol. Its IUPAC name is 7-chloro-2,2-dimethyl-1,3,4,10-tetrahydroacridin-9-one.
| Compound Name | 7-chloro-2,2-dimethyl-1,3,4,10-tetrahydroacridin-9-one |
|---|---|
| PubChem CID | 53362205 |
| Molecular Formula | C15H16ClNO |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 7-chloro-2,2-dimethyl-1,3,4,10-tetrahydroacridin-9-one |
| SMILES | CC1(C)CCc2[nH]c3ccc(Cl)cc3c(=O)c2C1 |
| InChI | InChI=1S/C15H16ClNO/c1-15(2)6-5-13-11(8-15)14(18)10-7-9(16)3-4-12(10)17-13/h3-4,7H,5-6,8H2,1-2H3,(H,17,18) |
| InChIKey | ADNIWBSZPSWJLD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |