C13H24OSi — CID 53362296
(3E,5E)-7,7-dimethyl-5-trimethylsilylocta-3,5-dien-2-one (PubChem CID 53362296) has the molecular formula C13H24OSi and a molecular weight of 224.42 g/mol. Its IUPAC name is (3E,5E)-7,7-dimethyl-5-trimethylsilylocta-3,5-dien-2-one.
| Compound Name | (3E,5E)-7,7-dimethyl-5-trimethylsilylocta-3,5-dien-2-one |
|---|---|
| PubChem CID | 53362296 |
| Molecular Formula | C13H24OSi |
| Molecular Weight | 224.42 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | (3E,5E)-7,7-dimethyl-5-trimethylsilylocta-3,5-dien-2-one |
| SMILES | CC(=O)/C=C/C(=C\C(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C13H24OSi/c1-11(14)8-9-12(15(5,6)7)10-13(2,3)4/h8-10H,1-7H3/b9-8+,12-10+ |
| InChIKey | AAIYXLWDYOASBF-CDKJVOIVSA-N |
| XLogP | 3.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|