C15H17NO3 — CID 53362374
5,6-dimethoxy-2,3,4,10-tetrahydro-1H-acridin-9-one (PubChem CID 53362374) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 5,6-dimethoxy-2,3,4,10-tetrahydro-1H-acridin-9-one.
| Compound Name | 5,6-dimethoxy-2,3,4,10-tetrahydro-1H-acridin-9-one |
|---|---|
| PubChem CID | 53362374 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 5,6-dimethoxy-2,3,4,10-tetrahydro-1H-acridin-9-one |
| SMILES | COc1ccc2c(=O)c3c([nH]c2c1OC)CCCC3 |
| InChI | InChI=1S/C15H17NO3/c1-18-12-8-7-10-13(15(12)19-2)16-11-6-4-3-5-9(11)14(10)17/h7-8H,3-6H2,1-2H3,(H,16,17) |
| InChIKey | COYDOXYQSDVBGE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |