C17H32O7 — CID 53362386
(4R,5E,8R,9R,10R)-8,9,10-tris(methoxymethoxy)undeca-1,5-dien-4-ol (PubChem CID 53362386) has the molecular formula C17H32O7 and a molecular weight of 348.44 g/mol. Its IUPAC name is (4R,5E,8R,9R,10R)-8,9,10-tris(methoxymethoxy)undeca-1,5-dien-4-ol.
| Compound Name | (4R,5E,8R,9R,10R)-8,9,10-tris(methoxymethoxy)undeca-1,5-dien-4-ol |
|---|---|
| PubChem CID | 53362386 |
| Molecular Formula | C17H32O7 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | (4R,5E,8R,9R,10R)-8,9,10-tris(methoxymethoxy)undeca-1,5-dien-4-ol |
| SMILES | C=CC[C@@H](O)/C=C/C[C@@H](OCOC)[C@H](OCOC)[C@@H](C)OCOC |
| InChI | InChI=1S/C17H32O7/c1-6-8-15(18)9-7-10-16(23-12-20-4)17(24-13-21-5)14(2)22-11-19-3/h6-7,9,14-18H,1,8,10-13H2,2-5H3/b9-7+/t14-,15-,16-,17-/m1/s1 |
| InChIKey | OHBAJKLXOCTJQV-JEPKMOIZSA-N |
| XLogP | 1.86 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|