C19H16FNO2 — CID 53362497
7-(4-fluorophenoxy)-2,3,4,10-tetrahydro-1H-acridin-9-one (PubChem CID 53362497) has the molecular formula C19H16FNO2 and a molecular weight of 309.34 g/mol. Its IUPAC name is 7-(4-fluorophenoxy)-2,3,4,10-tetrahydro-1H-acridin-9-one.
| Compound Name | 7-(4-fluorophenoxy)-2,3,4,10-tetrahydro-1H-acridin-9-one |
|---|---|
| PubChem CID | 53362497 |
| Molecular Formula | C19H16FNO2 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 7-(4-fluorophenoxy)-2,3,4,10-tetrahydro-1H-acridin-9-one |
| SMILES | O=c1c2c([nH]c3ccc(Oc4ccc(F)cc4)cc13)CCCC2 |
| InChI | InChI=1S/C19H16FNO2/c20-12-5-7-13(8-6-12)23-14-9-10-18-16(11-14)19(22)15-3-1-2-4-17(15)21-18/h5-11H,1-4H2,(H,21,22) |
| InChIKey | RREUSHOACGCOSP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |