C17H14N2OS — CID 53362550
8-pyridin-4-yl-1,3,4,5-tetrahydrothiopyrano[4,3-b]quinolin-10-one (PubChem CID 53362550) has the molecular formula C17H14N2OS and a molecular weight of 294.38 g/mol. Its IUPAC name is 8-pyridin-4-yl-1,3,4,5-tetrahydrothiopyrano[4,3-b]quinolin-10-one.
| Compound Name | 8-pyridin-4-yl-1,3,4,5-tetrahydrothiopyrano[4,3-b]quinolin-10-one |
|---|---|
| PubChem CID | 53362550 |
| Molecular Formula | C17H14N2OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 8-pyridin-4-yl-1,3,4,5-tetrahydrothiopyrano[4,3-b]quinolin-10-one |
| SMILES | O=c1c2c([nH]c3ccc(-c4ccncc4)cc13)CCSC2 |
| InChI | InChI=1S/C17H14N2OS/c20-17-13-9-12(11-3-6-18-7-4-11)1-2-15(13)19-16-5-8-21-10-14(16)17/h1-4,6-7,9H,5,8,10H2,(H,19,20) |
| InChIKey | DCAOVNLDCSNTGQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |