C24H48O4Si2 — CID 53362619
(2S)-2-[(1S,7S)-1,7-bis[[tert-butyl(dimethyl)silyl]oxy]octyl]-2H-furan-5-one (PubChem CID 53362619) has the molecular formula C24H48O4Si2 and a molecular weight of 456.82 g/mol. Its IUPAC name is (2S)-2-[(1S,7S)-1,7-bis[[tert-butyl(dimethyl)silyl]oxy]octyl]-2H-furan-5-one.
| Compound Name | (2S)-2-[(1S,7S)-1,7-bis[[tert-butyl(dimethyl)silyl]oxy]octyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 53362619 |
| Molecular Formula | C24H48O4Si2 |
| Molecular Weight | 456.82 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | (2S)-2-[(1S,7S)-1,7-bis[[tert-butyl(dimethyl)silyl]oxy]octyl]-2H-furan-5-one |
| SMILES | C[C@@H](CCCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C=CC(=O)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H48O4Si2/c1-19(27-29(8,9)23(2,3)4)15-13-12-14-16-21(20-17-18-22(25)26-20)28-30(10,11)24(5,6)7/h17-21H,12-16H2,1-11H3/t19-,20-,21-/m0/s1 |
| InChIKey | ZREQUEVPCHUEJG-ACRUOGEOSA-N |
| XLogP | 7.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.82 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|