About [(1R)-1-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-3-methylbutyl]boronic acid
[(1R)-1-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 53362664) has the molecular formula C9H21BN2O4
and a molecular weight of 232.09 g/mol. Its IUPAC name is [(1R)-1-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-3-methylbutyl]boronic acid.
Molecular Properties
| Compound Name | [(1R)-1-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-3-methylbutyl]boronic acid |
| PubChem CID | 53362664 |
| Molecular Formula | C9H21BN2O4 |
| Molecular Weight | 232.09 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | [(1R)-1-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)[C@@H](C)O)B(O)O |
| InChI | InChI=1S/C9H21BN2O4/c1-5(2)4-7(10(15)16)12-9(14)8(11)6(3)13/h5-8,13,15-16H,4,11H2,1-3H3,(H,12,14)/t6-,7+,8+/m1/s1 |
| InChIKey | PCKNEPNPPDWEFS-CSMHCCOUSA-N |
| XLogP | -1.76 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.09 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-1-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-3-methylbutyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-3-methylbutyl]boronic acid?
The IUPAC name of [(1R)-1-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-3-methylbutyl]boronic acid (CID 53362664) is [(1R)-1-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-3-methylbutyl]boronic acid.
What is the SMILES notation for [(1R)-1-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-3-methylbutyl]boronic acid?
The canonical SMILES for [(1R)-1-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-3-methylbutyl]boronic acid is CC(C)C[C@H](NC(=O)[C@@H](N)[C@@H](C)O)B(O)O.
What is the InChIKey of [(1R)-1-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-3-methylbutyl]boronic acid?
The InChIKey is PCKNEPNPPDWEFS-CSMHCCOUSA-N. The full InChI is InChI=1S/C9H21BN2O4/c1-5(2)4-7(10(15)16)12-9(14)8(11)6(3)13/h5-8,13,15-16H,4,11H2,1-3H3,(H,12,14)/t6-,7+,8+/m1/s1.
What are the key properties of [(1R)-1-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-3-methylbutyl]boronic acid?
[(1R)-1-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-3-methylbutyl]boronic acid has a molecular weight of 232.09 g/mol, XLogP of -1.76, 6 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-3-methylbutyl]boronic acid is sourced from PubChem (CID 53362664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).