About N-[4-[(E)-N-(3-aminopropoxy)-C-methylcarbonimidoyl]phenyl]furo[2,3-b]quinolin-4-amine
N-[4-[(E)-N-(3-aminopropoxy)-C-methylcarbonimidoyl]phenyl]furo[2,3-b]quinolin-4-amine (PubChem CID 53362683) has the molecular formula C22H22N4O2
and a molecular weight of 374.44 g/mol. Its IUPAC name is N-[4-[(E)-N-(3-aminopropoxy)-C-methylcarbonimidoyl]phenyl]furo[2,3-b]quinolin-4-amine.
Molecular Properties
| Compound Name | N-[4-[(E)-N-(3-aminopropoxy)-C-methylcarbonimidoyl]phenyl]furo[2,3-b]quinolin-4-amine |
| PubChem CID | 53362683 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | N-[4-[(E)-N-(3-aminopropoxy)-C-methylcarbonimidoyl]phenyl]furo[2,3-b]quinolin-4-amine |
| SMILES | C/C(=N\OCCCN)c1ccc(Nc2c3ccccc3nc3occc23)cc1 |
| InChI | InChI=1S/C22H22N4O2/c1-15(26-28-13-4-12-23)16-7-9-17(10-8-16)24-21-18-5-2-3-6-20(18)25-22-19(21)11-14-27-22/h2-3,5-11,14H,4,12-13,23H2,1H3,(H,24,25)/b26-15+ |
| InChIKey | NHTYTQQUOJEWOV-CVKSISIWSA-N |
| XLogP | 4.81 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(E)-N-(3-aminopropoxy)-C-methylcarbonimidoyl]phenyl]furo[2,3-b]quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(E)-N-(3-aminopropoxy)-C-methylcarbonimidoyl]phenyl]furo[2,3-b]quinolin-4-amine?
The IUPAC name of N-[4-[(E)-N-(3-aminopropoxy)-C-methylcarbonimidoyl]phenyl]furo[2,3-b]quinolin-4-amine (CID 53362683) is N-[4-[(E)-N-(3-aminopropoxy)-C-methylcarbonimidoyl]phenyl]furo[2,3-b]quinolin-4-amine.
What is the SMILES notation for N-[4-[(E)-N-(3-aminopropoxy)-C-methylcarbonimidoyl]phenyl]furo[2,3-b]quinolin-4-amine?
The canonical SMILES for N-[4-[(E)-N-(3-aminopropoxy)-C-methylcarbonimidoyl]phenyl]furo[2,3-b]quinolin-4-amine is C/C(=N\OCCCN)c1ccc(Nc2c3ccccc3nc3occc23)cc1.
What is the InChIKey of N-[4-[(E)-N-(3-aminopropoxy)-C-methylcarbonimidoyl]phenyl]furo[2,3-b]quinolin-4-amine?
The InChIKey is NHTYTQQUOJEWOV-CVKSISIWSA-N. The full InChI is InChI=1S/C22H22N4O2/c1-15(26-28-13-4-12-23)16-7-9-17(10-8-16)24-21-18-5-2-3-6-20(18)25-22-19(21)11-14-27-22/h2-3,5-11,14H,4,12-13,23H2,1H3,(H,24,25)/b26-15+.
What are the key properties of N-[4-[(E)-N-(3-aminopropoxy)-C-methylcarbonimidoyl]phenyl]furo[2,3-b]quinolin-4-amine?
N-[4-[(E)-N-(3-aminopropoxy)-C-methylcarbonimidoyl]phenyl]furo[2,3-b]quinolin-4-amine has a molecular weight of 374.44 g/mol, XLogP of 4.81, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(E)-N-(3-aminopropoxy)-C-methylcarbonimidoyl]phenyl]furo[2,3-b]quinolin-4-amine is sourced from PubChem (CID 53362683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).