C19H22N2 — CID 53362719
(6aR)-6-propyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-amine (PubChem CID 53362719) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is (6aR)-6-propyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-amine.
| Compound Name | (6aR)-6-propyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-amine |
|---|---|
| PubChem CID | 53362719 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | (6aR)-6-propyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-amine |
| SMILES | CCCN1CCc2cccc3c2[C@H]1Cc1cccc(N)c1-3 |
| InChI | InChI=1S/C19H22N2/c1-2-10-21-11-9-13-5-3-7-15-18-14(6-4-8-16(18)20)12-17(21)19(13)15/h3-8,17H,2,9-12,20H2,1H3/t17-/m1/s1 |
| InChIKey | LKVRAIZDZUXRII-QGZVFWFLSA-N |
| XLogP | 3.80 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|