C18H17BF2N2 — CID 53362825
2,2-difluoro-8-(2,4,6-trimethylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 53362825) has the molecular formula C18H17BF2N2 and a molecular weight of 310.16 g/mol. Its IUPAC name is 2,2-difluoro-8-(2,4,6-trimethylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-8-(2,4,6-trimethylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 53362825 |
| Molecular Formula | C18H17BF2N2 |
| Molecular Weight | 310.16 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 2,2-difluoro-8-(2,4,6-trimethylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | Cc1cc(C)c(C2=C3C=CC=[N+]3[B-](F)(F)n3cccc32)c(C)c1 |
| InChI | InChI=1S/C18H17BF2N2/c1-12-10-13(2)17(14(3)11-12)18-15-6-4-8-22(15)19(20,21)23-9-5-7-16(18)23/h4-11H,1-3H3 |
| InChIKey | AKUQOWACWGHDSF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.16 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|