About (2R,6S)-2-ethenyl-6-(iodomethyl)-4,4-dimethoxyoxane
(2R,6S)-2-ethenyl-6-(iodomethyl)-4,4-dimethoxyoxane (PubChem CID 53362875) has the molecular formula C10H17IO3
and a molecular weight of 312.15 g/mol. Its IUPAC name is (2R,6S)-2-ethenyl-6-(iodomethyl)-4,4-dimethoxyoxane.
Molecular Properties
| Compound Name | (2R,6S)-2-ethenyl-6-(iodomethyl)-4,4-dimethoxyoxane |
| PubChem CID | 53362875 |
| Molecular Formula | C10H17IO3 |
| Molecular Weight | 312.15 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | (2R,6S)-2-ethenyl-6-(iodomethyl)-4,4-dimethoxyoxane |
| SMILES | C=C[C@H]1CC(OC)(OC)C[C@@H](CI)O1 |
| InChI | InChI=1S/C10H17IO3/c1-4-8-5-10(12-2,13-3)6-9(7-11)14-8/h4,8-9H,1,5-7H2,2-3H3/t8-,9-/m0/s1 |
| InChIKey | SQLCUUOGILJGHP-IUCAKERBSA-N |
| XLogP | 2.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.15 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R,6S)-2-ethenyl-6-(iodomethyl)-4,4-dimethoxyoxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6S)-2-ethenyl-6-(iodomethyl)-4,4-dimethoxyoxane?
The IUPAC name of (2R,6S)-2-ethenyl-6-(iodomethyl)-4,4-dimethoxyoxane (CID 53362875) is (2R,6S)-2-ethenyl-6-(iodomethyl)-4,4-dimethoxyoxane.
What is the SMILES notation for (2R,6S)-2-ethenyl-6-(iodomethyl)-4,4-dimethoxyoxane?
The canonical SMILES for (2R,6S)-2-ethenyl-6-(iodomethyl)-4,4-dimethoxyoxane is C=C[C@H]1CC(OC)(OC)C[C@@H](CI)O1.
What is the InChIKey of (2R,6S)-2-ethenyl-6-(iodomethyl)-4,4-dimethoxyoxane?
The InChIKey is SQLCUUOGILJGHP-IUCAKERBSA-N. The full InChI is InChI=1S/C10H17IO3/c1-4-8-5-10(12-2,13-3)6-9(7-11)14-8/h4,8-9H,1,5-7H2,2-3H3/t8-,9-/m0/s1.
What are the key properties of (2R,6S)-2-ethenyl-6-(iodomethyl)-4,4-dimethoxyoxane?
(2R,6S)-2-ethenyl-6-(iodomethyl)-4,4-dimethoxyoxane has a molecular weight of 312.15 g/mol, XLogP of 2.14, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6S)-2-ethenyl-6-(iodomethyl)-4,4-dimethoxyoxane is sourced from PubChem (CID 53362875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).