C11H12N6O — CID 53363027
N-[3-[(4-amino-1,3,5-triazin-2-yl)amino]phenyl]acetamide (PubChem CID 53363027) has the molecular formula C11H12N6O and a molecular weight of 244.26 g/mol. Its IUPAC name is N-[3-[(4-amino-1,3,5-triazin-2-yl)amino]phenyl]acetamide.
| Compound Name | N-[3-[(4-amino-1,3,5-triazin-2-yl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 53363027 |
| Molecular Formula | C11H12N6O |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | N-[3-[(4-amino-1,3,5-triazin-2-yl)amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Nc2ncnc(N)n2)c1 |
| InChI | InChI=1S/C11H12N6O/c1-7(18)15-8-3-2-4-9(5-8)16-11-14-6-13-10(12)17-11/h2-6H,1H3,(H,15,18)(H3,12,13,14,16,17) |
| InChIKey | OKZWSYZQMUGXGB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |