About 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl-methylamino]-3-(4-ethoxyphenoxy)propan-2-ol
1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl-methylamino]-3-(4-ethoxyphenoxy)propan-2-ol (PubChem CID 53363425) has the molecular formula C25H33N3O3
and a molecular weight of 423.56 g/mol. Its IUPAC name is 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl-methylamino]-3-(4-ethoxyphenoxy)propan-2-ol.
Molecular Properties
| Compound Name | 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl-methylamino]-3-(4-ethoxyphenoxy)propan-2-ol |
| PubChem CID | 53363425 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl-methylamino]-3-(4-ethoxyphenoxy)propan-2-ol |
| SMILES | CCOc1ccc(OCC(O)CN(C)Cc2c(C)nn(Cc3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C25H33N3O3/c1-5-30-23-11-13-24(14-12-23)31-18-22(29)16-27(4)17-25-19(2)26-28(20(25)3)15-21-9-7-6-8-10-21/h6-14,22,29H,5,15-18H2,1-4H3 |
| InChIKey | VYEZMJXAJMMPSX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl-methylamino]-3-(4-ethoxyphenoxy)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl-methylamino]-3-(4-ethoxyphenoxy)propan-2-ol?
The IUPAC name of 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl-methylamino]-3-(4-ethoxyphenoxy)propan-2-ol (CID 53363425) is 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl-methylamino]-3-(4-ethoxyphenoxy)propan-2-ol.
What is the SMILES notation for 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl-methylamino]-3-(4-ethoxyphenoxy)propan-2-ol?
The canonical SMILES for 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl-methylamino]-3-(4-ethoxyphenoxy)propan-2-ol is CCOc1ccc(OCC(O)CN(C)Cc2c(C)nn(Cc3ccccc3)c2C)cc1.
What is the InChIKey of 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl-methylamino]-3-(4-ethoxyphenoxy)propan-2-ol?
The InChIKey is VYEZMJXAJMMPSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H33N3O3/c1-5-30-23-11-13-24(14-12-23)31-18-22(29)16-27(4)17-25-19(2)26-28(20(25)3)15-21-9-7-6-8-10-21/h6-14,22,29H,5,15-18H2,1-4H3.
What are the key properties of 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl-methylamino]-3-(4-ethoxyphenoxy)propan-2-ol?
1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl-methylamino]-3-(4-ethoxyphenoxy)propan-2-ol has a molecular weight of 423.56 g/mol, XLogP of 3.82, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl-methylamino]-3-(4-ethoxyphenoxy)propan-2-ol is sourced from PubChem (CID 53363425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).