C22H31F2NO3S — CID 53363464
[(8S,9S,13R,14S,17R)-17-(2,2-difluoroethyl)-2-ethyl-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] sulfamate (PubChem CID 53363464) has the molecular formula C22H31F2NO3S and a molecular weight of 427.56 g/mol. Its IUPAC name is [(8S,9S,13R,14S,17R)-17-(2,2-difluoroethyl)-2-ethyl-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] sulfamate.
| Compound Name | [(8S,9S,13R,14S,17R)-17-(2,2-difluoroethyl)-2-ethyl-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] sulfamate |
|---|---|
| PubChem CID | 53363464 |
| Molecular Formula | C22H31F2NO3S |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | [(8S,9S,13R,14S,17R)-17-(2,2-difluoroethyl)-2-ethyl-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] sulfamate |
| SMILES | CCc1cc2c(cc1OS(N)(=O)=O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](CC(F)F)CC[C@@H]12 |
| InChI | InChI=1S/C22H31F2NO3S/c1-3-13-10-18-14(11-20(13)28-29(25,26)27)4-6-17-16(18)8-9-22(2)15(12-21(23)24)5-7-19(17)22/h10-11,15-17,19,21H,3-9,12H2,1-2H3,(H2,25,26,27)/t15-,16+,17-,19+,22-/m1/s1 |
| InChIKey | PQAHOWIKYWLQKM-QGAUHXJISA-N |
| XLogP | 4.96 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |