About (2-phenyl-1,3-oxazol-4-yl)-(3,4,5-trimethoxyphenyl)methanone
(2-phenyl-1,3-oxazol-4-yl)-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 53363700) has the molecular formula C19H17NO5
and a molecular weight of 339.35 g/mol. Its IUPAC name is (2-phenyl-1,3-oxazol-4-yl)-(3,4,5-trimethoxyphenyl)methanone.
Molecular Properties
| Compound Name | (2-phenyl-1,3-oxazol-4-yl)-(3,4,5-trimethoxyphenyl)methanone |
| PubChem CID | 53363700 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (2-phenyl-1,3-oxazol-4-yl)-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)c2coc(-c3ccccc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C19H17NO5/c1-22-15-9-13(10-16(23-2)18(15)24-3)17(21)14-11-25-19(20-14)12-7-5-4-6-8-12/h4-11H,1-3H3 |
| InChIKey | YSZWUFPOMPOSSS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-phenyl-1,3-oxazol-4-yl)-(3,4,5-trimethoxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenyl-1,3-oxazol-4-yl)-(3,4,5-trimethoxyphenyl)methanone?
The IUPAC name of (2-phenyl-1,3-oxazol-4-yl)-(3,4,5-trimethoxyphenyl)methanone (CID 53363700) is (2-phenyl-1,3-oxazol-4-yl)-(3,4,5-trimethoxyphenyl)methanone.
What is the SMILES notation for (2-phenyl-1,3-oxazol-4-yl)-(3,4,5-trimethoxyphenyl)methanone?
The canonical SMILES for (2-phenyl-1,3-oxazol-4-yl)-(3,4,5-trimethoxyphenyl)methanone is COc1cc(C(=O)c2coc(-c3ccccc3)n2)cc(OC)c1OC.
What is the InChIKey of (2-phenyl-1,3-oxazol-4-yl)-(3,4,5-trimethoxyphenyl)methanone?
The InChIKey is YSZWUFPOMPOSSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO5/c1-22-15-9-13(10-16(23-2)18(15)24-3)17(21)14-11-25-19(20-14)12-7-5-4-6-8-12/h4-11H,1-3H3.
What are the key properties of (2-phenyl-1,3-oxazol-4-yl)-(3,4,5-trimethoxyphenyl)methanone?
(2-phenyl-1,3-oxazol-4-yl)-(3,4,5-trimethoxyphenyl)methanone has a molecular weight of 339.35 g/mol, XLogP of 3.60, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenyl-1,3-oxazol-4-yl)-(3,4,5-trimethoxyphenyl)methanone is sourced from PubChem (CID 53363700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).