About 4-(6-fluoro-3-oxo-1,2-benzothiazol-2-yl)benzonitrile
4-(6-fluoro-3-oxo-1,2-benzothiazol-2-yl)benzonitrile (PubChem CID 53363920) has the molecular formula C14H7FN2OS
and a molecular weight of 270.29 g/mol. Its IUPAC name is 4-(6-fluoro-3-oxo-1,2-benzothiazol-2-yl)benzonitrile.
Molecular Properties
| Compound Name | 4-(6-fluoro-3-oxo-1,2-benzothiazol-2-yl)benzonitrile |
| PubChem CID | 53363920 |
| Molecular Formula | C14H7FN2OS |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 4-(6-fluoro-3-oxo-1,2-benzothiazol-2-yl)benzonitrile |
| SMILES | N#Cc1ccc(-n2sc3cc(F)ccc3c2=O)cc1 |
| InChI | InChI=1S/C14H7FN2OS/c15-10-3-6-12-13(7-10)19-17(14(12)18)11-4-1-9(8-16)2-5-11/h1-7H |
| InChIKey | KHQNOPMBOXXRNW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(6-fluoro-3-oxo-1,2-benzothiazol-2-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-fluoro-3-oxo-1,2-benzothiazol-2-yl)benzonitrile?
The IUPAC name of 4-(6-fluoro-3-oxo-1,2-benzothiazol-2-yl)benzonitrile (CID 53363920) is 4-(6-fluoro-3-oxo-1,2-benzothiazol-2-yl)benzonitrile.
What is the SMILES notation for 4-(6-fluoro-3-oxo-1,2-benzothiazol-2-yl)benzonitrile?
The canonical SMILES for 4-(6-fluoro-3-oxo-1,2-benzothiazol-2-yl)benzonitrile is N#Cc1ccc(-n2sc3cc(F)ccc3c2=O)cc1.
What is the InChIKey of 4-(6-fluoro-3-oxo-1,2-benzothiazol-2-yl)benzonitrile?
The InChIKey is KHQNOPMBOXXRNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7FN2OS/c15-10-3-6-12-13(7-10)19-17(14(12)18)11-4-1-9(8-16)2-5-11/h1-7H.
What are the key properties of 4-(6-fluoro-3-oxo-1,2-benzothiazol-2-yl)benzonitrile?
4-(6-fluoro-3-oxo-1,2-benzothiazol-2-yl)benzonitrile has a molecular weight of 270.29 g/mol, XLogP of 3.06, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-fluoro-3-oxo-1,2-benzothiazol-2-yl)benzonitrile is sourced from PubChem (CID 53363920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).