C25H26N4O3 — CID 53363971
(E)-3-[4-[[2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-indol-3-yl]ethylamino]methyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 53363971) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is (E)-3-[4-[[2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-indol-3-yl]ethylamino]methyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[4-[[2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-indol-3-yl]ethylamino]methyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 53363971 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | (E)-3-[4-[[2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-indol-3-yl]ethylamino]methyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | Cc1noc(C)c1-c1[nH]c2ccccc2c1CCNCc1ccc(/C=C/C(=O)NO)cc1 |
| InChI | InChI=1S/C25H26N4O3/c1-16-24(17(2)32-29-16)25-21(20-5-3-4-6-22(20)27-25)13-14-26-15-19-9-7-18(8-10-19)11-12-23(30)28-31/h3-12,26-27,31H,13-15H2,1-2H3,(H,28,30)/b12-11+ |
| InChIKey | JUFMUTAMQLDDPW-VAWYXSNFSA-N |
| XLogP | 4.29 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|