C24H20N4Si — CID 53364010
2-[4-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)phenyl]ethynyl-trimethylsilane (PubChem CID 53364010) has the molecular formula C24H20N4Si and a molecular weight of 392.54 g/mol. Its IUPAC name is 2-[4-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)phenyl]ethynyl-trimethylsilane.
| Compound Name | 2-[4-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)phenyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 53364010 |
| Molecular Formula | C24H20N4Si |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 2-[4-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)phenyl]ethynyl-trimethylsilane |
| SMILES | C[Si](C)(C)C#Cc1ccc(-c2nc3c4cccnc4c4ncccc4c3[nH]2)cc1 |
| InChI | InChI=1S/C24H20N4Si/c1-29(2,3)15-12-16-8-10-17(11-9-16)24-27-22-18-6-4-13-25-20(18)21-19(23(22)28-24)7-5-14-26-21/h4-11,13-14H,1-3H3,(H,27,28) |
| InChIKey | AKIGUKMUUREGKD-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|