C30H22N4O8 — CID 53364156
1-[3-[3-[3-(2,4-dioxo-1,3-diazinan-1-yl)phenoxy]-1,4-dioxonaphthalen-2-yl]oxyphenyl]-1,3-diazinane-2,4-dione (PubChem CID 53364156) has the molecular formula C30H22N4O8 and a molecular weight of 566.53 g/mol. Its IUPAC name is 1-[3-[3-[3-(2,4-dioxo-1,3-diazinan-1-yl)phenoxy]-1,4-dioxonaphthalen-2-yl]oxyphenyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[3-[3-[3-(2,4-dioxo-1,3-diazinan-1-yl)phenoxy]-1,4-dioxonaphthalen-2-yl]oxyphenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 53364156 |
| Molecular Formula | C30H22N4O8 |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 566.14 |
| IUPAC Name | 1-[3-[3-[3-(2,4-dioxo-1,3-diazinan-1-yl)phenoxy]-1,4-dioxonaphthalen-2-yl]oxyphenyl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(c2cccc(OC3=C(Oc4cccc(N5CCC(=O)NC5=O)c4)C(=O)c4ccccc4C3=O)c2)C(=O)N1 |
| InChI | InChI=1S/C30H22N4O8/c35-23-11-13-33(29(39)31-23)17-5-3-7-19(15-17)41-27-25(37)21-9-1-2-10-22(21)26(38)28(27)42-20-8-4-6-18(16-20)34-14-12-24(36)32-30(34)40/h1-10,15-16H,11-14H2,(H,31,35,39)(H,32,36,40) |
| InChIKey | UKSFLHBPGMNKIH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|