C23H23N3O3 — CID 53364337
(16E)-11-methoxy-14,19-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8(26),9,11,16,21(25),22-decaene (PubChem CID 53364337) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is (16E)-11-methoxy-14,19-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8(26),9,11,16,21(25),22-decaene.
| Compound Name | (16E)-11-methoxy-14,19-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8(26),9,11,16,21(25),22-decaene |
|---|---|
| PubChem CID | 53364337 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | (16E)-11-methoxy-14,19-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8(26),9,11,16,21(25),22-decaene |
| SMILES | COc1ccc2cc1COC/C=C/COCc1cccc(c1)-c1ccnc(n1)N2 |
| InChI | InChI=1S/C23H23N3O3/c1-27-22-8-7-20-14-19(22)16-29-12-3-2-11-28-15-17-5-4-6-18(13-17)21-9-10-24-23(25-20)26-21/h2-10,13-14H,11-12,15-16H2,1H3,(H,24,25,26)/b3-2+ |
| InChIKey | NVVRIZGTMNCPSN-NSCUHMNNSA-N |
| XLogP | 4.50 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|