C22H26N2O4 — CID 5336437
ethyl (5E)-5-hydroxyimino-4-(4-methoxyphenyl)-2,7,7-trimethyl-6,8-dihydroquinoline-3-carboxylate (PubChem CID 5336437) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is ethyl (5E)-5-hydroxyimino-4-(4-methoxyphenyl)-2,7,7-trimethyl-6,8-dihydroquinoline-3-carboxylate.
| Compound Name | ethyl (5E)-5-hydroxyimino-4-(4-methoxyphenyl)-2,7,7-trimethyl-6,8-dihydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 5336437 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | ethyl (5E)-5-hydroxyimino-4-(4-methoxyphenyl)-2,7,7-trimethyl-6,8-dihydroquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)nc2c(c1-c1ccc(OC)cc1)/C(=N/O)CC(C)(C)C2 |
| InChI | InChI=1S/C22H26N2O4/c1-6-28-21(25)18-13(2)23-16-11-22(3,4)12-17(24-26)20(16)19(18)14-7-9-15(27-5)10-8-14/h7-10,26H,6,11-12H2,1-5H3/b24-17+ |
| InChIKey | NPZDIUOZGOJUKD-JJIBRWJFSA-N |
| XLogP | 4.39 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|