C27H42O4 — CID 53364437
methyl (1S,3S,5R)-3-acetyl-4,4-dimethyl-1,3,5-tris(3-methylbut-2-enyl)-2-oxocyclohexane-1-carboxylate (PubChem CID 53364437) has the molecular formula C27H42O4 and a molecular weight of 430.63 g/mol. Its IUPAC name is methyl (1S,3S,5R)-3-acetyl-4,4-dimethyl-1,3,5-tris(3-methylbut-2-enyl)-2-oxocyclohexane-1-carboxylate.
| Compound Name | methyl (1S,3S,5R)-3-acetyl-4,4-dimethyl-1,3,5-tris(3-methylbut-2-enyl)-2-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 53364437 |
| Molecular Formula | C27H42O4 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | methyl (1S,3S,5R)-3-acetyl-4,4-dimethyl-1,3,5-tris(3-methylbut-2-enyl)-2-oxocyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@@]1(CC=C(C)C)C[C@@H](CC=C(C)C)C(C)(C)[C@@](CC=C(C)C)(C(C)=O)C1=O |
| InChI | InChI=1S/C27H42O4/c1-18(2)11-12-22-17-26(24(30)31-10,15-13-19(3)4)23(29)27(21(7)28,25(22,8)9)16-14-20(5)6/h11,13-14,22H,12,15-17H2,1-10H3/t22-,26+,27+/m1/s1 |
| InChIKey | AHCRPPLGPYZATM-ICTDUYRTSA-N |
| XLogP | 6.41 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|