C21H30O4 — CID 53364440
methyl (1S,5R)-3-acetyl-4-methyl-1,5-bis(3-methylbut-2-enyl)-2-oxocyclohex-3-ene-1-carboxylate (PubChem CID 53364440) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is methyl (1S,5R)-3-acetyl-4-methyl-1,5-bis(3-methylbut-2-enyl)-2-oxocyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1S,5R)-3-acetyl-4-methyl-1,5-bis(3-methylbut-2-enyl)-2-oxocyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 53364440 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | methyl (1S,5R)-3-acetyl-4-methyl-1,5-bis(3-methylbut-2-enyl)-2-oxocyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(CC=C(C)C)C[C@@H](CC=C(C)C)C(C)=C(C(C)=O)C1=O |
| InChI | InChI=1S/C21H30O4/c1-13(2)8-9-17-12-21(20(24)25-7,11-10-14(3)4)19(23)18(15(17)5)16(6)22/h8,10,17H,9,11-12H2,1-7H3/t17-,21+/m1/s1 |
| InChIKey | JASZXWCJQHJNGD-UTKZUKDTSA-N |
| XLogP | 4.35 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|