C21H30O5 — CID 53364442
dimethyl 5-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methyl-2-oxocyclohex-3-ene-1,3-dicarboxylate (PubChem CID 53364442) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is dimethyl 5-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methyl-2-oxocyclohex-3-ene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methyl-2-oxocyclohex-3-ene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 53364442 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | dimethyl 5-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methyl-2-oxocyclohex-3-ene-1,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C)C(C/C=C(\C)CCC=C(C)C)CC(C(=O)OC)C1=O |
| InChI | InChI=1S/C21H30O5/c1-13(2)8-7-9-14(3)10-11-16-12-17(20(23)25-5)19(22)18(15(16)4)21(24)26-6/h8,10,16-17H,7,9,11-12H2,1-6H3/b14-10+ |
| InChIKey | FPLYDRNFRAZEOA-GXDHUFHOSA-N |
| XLogP | 3.94 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|