C18H28O4 — CID 53364450
cis-methyl (1S,5R)-3-acetyl-1,4,4-trimethyl-5-(3-methylbut-2-enyl)-2-oxocyclohexane-1-carboxylate (PubChem CID 53364450) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is cis-methyl (1S,5R)-3-acetyl-1,4,4-trimethyl-5-(3-methylbut-2-enyl)-2-oxocyclohexane-1-carboxylate.
| Compound Name | cis-methyl (1S,5R)-3-acetyl-1,4,4-trimethyl-5-(3-methylbut-2-enyl)-2-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 53364450 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | cis-methyl (1S,5R)-3-acetyl-1,4,4-trimethyl-5-(3-methylbut-2-enyl)-2-oxocyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)C[C@@H](CC=C(C)C)C(C)(C)C(C(C)=O)C1=O |
| InChI | InChI=1S/C18H28O4/c1-11(2)8-9-13-10-18(6,16(21)22-7)15(20)14(12(3)19)17(13,4)5/h8,13-14H,9-10H2,1-7H3/t13-,14?,18+/m1/s1 |
| InChIKey | OFRRKIISGYKKNS-RFQFSVLTSA-N |
| XLogP | 3.34 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|