About methyl (1S,5R)-3-acetyl-1,4-dimethyl-5-(3-methylbut-2-enyl)-2-oxocyclohex-3-ene-1-carboxylate
methyl (1S,5R)-3-acetyl-1,4-dimethyl-5-(3-methylbut-2-enyl)-2-oxocyclohex-3-ene-1-carboxylate (PubChem CID 53364458) has the molecular formula C17H24O4
and a molecular weight of 292.38 g/mol. Its IUPAC name is methyl (1S,5R)-3-acetyl-1,4-dimethyl-5-(3-methylbut-2-enyl)-2-oxocyclohex-3-ene-1-carboxylate.
Molecular Properties
| Compound Name | methyl (1S,5R)-3-acetyl-1,4-dimethyl-5-(3-methylbut-2-enyl)-2-oxocyclohex-3-ene-1-carboxylate |
| PubChem CID | 53364458 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | methyl (1S,5R)-3-acetyl-1,4-dimethyl-5-(3-methylbut-2-enyl)-2-oxocyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)C[C@@H](CC=C(C)C)C(C)=C(C(C)=O)C1=O |
| InChI | InChI=1S/C17H24O4/c1-10(2)7-8-13-9-17(5,16(20)21-6)15(19)14(11(13)3)12(4)18/h7,13H,8-9H2,1-6H3/t13-,17+/m1/s1 |
| InChIKey | YMVCNUGHVJVWPB-DYVFJYSZSA-N |
| XLogP | 3.02 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze methyl (1S,5R)-3-acetyl-1,4-dimethyl-5-(3-methylbut-2-enyl)-2-oxocyclohex-3-ene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (1S,5R)-3-acetyl-1,4-dimethyl-5-(3-methylbut-2-enyl)-2-oxocyclohex-3-ene-1-carboxylate?
The IUPAC name of methyl (1S,5R)-3-acetyl-1,4-dimethyl-5-(3-methylbut-2-enyl)-2-oxocyclohex-3-ene-1-carboxylate (CID 53364458) is methyl (1S,5R)-3-acetyl-1,4-dimethyl-5-(3-methylbut-2-enyl)-2-oxocyclohex-3-ene-1-carboxylate.
What is the SMILES notation for methyl (1S,5R)-3-acetyl-1,4-dimethyl-5-(3-methylbut-2-enyl)-2-oxocyclohex-3-ene-1-carboxylate?
The canonical SMILES for methyl (1S,5R)-3-acetyl-1,4-dimethyl-5-(3-methylbut-2-enyl)-2-oxocyclohex-3-ene-1-carboxylate is COC(=O)[C@@]1(C)C[C@@H](CC=C(C)C)C(C)=C(C(C)=O)C1=O.
What is the InChIKey of methyl (1S,5R)-3-acetyl-1,4-dimethyl-5-(3-methylbut-2-enyl)-2-oxocyclohex-3-ene-1-carboxylate?
The InChIKey is YMVCNUGHVJVWPB-DYVFJYSZSA-N. The full InChI is InChI=1S/C17H24O4/c1-10(2)7-8-13-9-17(5,16(20)21-6)15(19)14(11(13)3)12(4)18/h7,13H,8-9H2,1-6H3/t13-,17+/m1/s1.
What are the key properties of methyl (1S,5R)-3-acetyl-1,4-dimethyl-5-(3-methylbut-2-enyl)-2-oxocyclohex-3-ene-1-carboxylate?
methyl (1S,5R)-3-acetyl-1,4-dimethyl-5-(3-methylbut-2-enyl)-2-oxocyclohex-3-ene-1-carboxylate has a molecular weight of 292.38 g/mol, XLogP of 3.02, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1S,5R)-3-acetyl-1,4-dimethyl-5-(3-methylbut-2-enyl)-2-oxocyclohex-3-ene-1-carboxylate is sourced from PubChem (CID 53364458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).