About (6-chloro-1,2-benzoxazol-3-yl) morpholine-4-carboxylate
(6-chloro-1,2-benzoxazol-3-yl) morpholine-4-carboxylate (PubChem CID 53364501) has the molecular formula C12H11ClN2O4
and a molecular weight of 282.68 g/mol. Its IUPAC name is (6-chloro-1,2-benzoxazol-3-yl) morpholine-4-carboxylate.
Molecular Properties
| Compound Name | (6-chloro-1,2-benzoxazol-3-yl) morpholine-4-carboxylate |
| PubChem CID | 53364501 |
| Molecular Formula | C12H11ClN2O4 |
| Molecular Weight | 282.68 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | (6-chloro-1,2-benzoxazol-3-yl) morpholine-4-carboxylate |
| SMILES | O=C(Oc1noc2cc(Cl)ccc12)N1CCOCC1 |
| InChI | InChI=1S/C12H11ClN2O4/c13-8-1-2-9-10(7-8)19-14-11(9)18-12(16)15-3-5-17-6-4-15/h1-2,7H,3-6H2 |
| InChIKey | DQZUSDBQCBLETH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.68 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (6-chloro-1,2-benzoxazol-3-yl) morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-1,2-benzoxazol-3-yl) morpholine-4-carboxylate?
The IUPAC name of (6-chloro-1,2-benzoxazol-3-yl) morpholine-4-carboxylate (CID 53364501) is (6-chloro-1,2-benzoxazol-3-yl) morpholine-4-carboxylate.
What is the SMILES notation for (6-chloro-1,2-benzoxazol-3-yl) morpholine-4-carboxylate?
The canonical SMILES for (6-chloro-1,2-benzoxazol-3-yl) morpholine-4-carboxylate is O=C(Oc1noc2cc(Cl)ccc12)N1CCOCC1.
What is the InChIKey of (6-chloro-1,2-benzoxazol-3-yl) morpholine-4-carboxylate?
The InChIKey is DQZUSDBQCBLETH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClN2O4/c13-8-1-2-9-10(7-8)19-14-11(9)18-12(16)15-3-5-17-6-4-15/h1-2,7H,3-6H2.
What are the key properties of (6-chloro-1,2-benzoxazol-3-yl) morpholine-4-carboxylate?
(6-chloro-1,2-benzoxazol-3-yl) morpholine-4-carboxylate has a molecular weight of 282.68 g/mol, XLogP of 2.31, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-1,2-benzoxazol-3-yl) morpholine-4-carboxylate is sourced from PubChem (CID 53364501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).