About (5-phenyl-2-pyridinyl) 4-(2-methylquinolin-4-yl)piperazine-1-carboxylate
(5-phenyl-2-pyridinyl) 4-(2-methylquinolin-4-yl)piperazine-1-carboxylate (PubChem CID 53364507) has the molecular formula C26H24N4O2
and a molecular weight of 424.50 g/mol. Its IUPAC name is (5-phenyl-2-pyridinyl) 4-(2-methylquinolin-4-yl)piperazine-1-carboxylate.
Molecular Properties
| Compound Name | (5-phenyl-2-pyridinyl) 4-(2-methylquinolin-4-yl)piperazine-1-carboxylate |
| PubChem CID | 53364507 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | (5-phenyl-2-pyridinyl) 4-(2-methylquinolin-4-yl)piperazine-1-carboxylate |
| SMILES | Cc1cc(N2CCN(C(=O)Oc3ccc(-c4ccccc4)cn3)CC2)c2ccccc2n1 |
| InChI | InChI=1S/C26H24N4O2/c1-19-17-24(22-9-5-6-10-23(22)28-19)29-13-15-30(16-14-29)26(31)32-25-12-11-21(18-27-25)20-7-3-2-4-8-20/h2-12,17-18H,13-16H2,1H3 |
| InChIKey | UJAPZGDOBGLQJC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-phenyl-2-pyridinyl) 4-(2-methylquinolin-4-yl)piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-phenyl-2-pyridinyl) 4-(2-methylquinolin-4-yl)piperazine-1-carboxylate?
The IUPAC name of (5-phenyl-2-pyridinyl) 4-(2-methylquinolin-4-yl)piperazine-1-carboxylate (CID 53364507) is (5-phenyl-2-pyridinyl) 4-(2-methylquinolin-4-yl)piperazine-1-carboxylate.
What is the SMILES notation for (5-phenyl-2-pyridinyl) 4-(2-methylquinolin-4-yl)piperazine-1-carboxylate?
The canonical SMILES for (5-phenyl-2-pyridinyl) 4-(2-methylquinolin-4-yl)piperazine-1-carboxylate is Cc1cc(N2CCN(C(=O)Oc3ccc(-c4ccccc4)cn3)CC2)c2ccccc2n1.
What is the InChIKey of (5-phenyl-2-pyridinyl) 4-(2-methylquinolin-4-yl)piperazine-1-carboxylate?
The InChIKey is UJAPZGDOBGLQJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24N4O2/c1-19-17-24(22-9-5-6-10-23(22)28-19)29-13-15-30(16-14-29)26(31)32-25-12-11-21(18-27-25)20-7-3-2-4-8-20/h2-12,17-18H,13-16H2,1H3.
What are the key properties of (5-phenyl-2-pyridinyl) 4-(2-methylquinolin-4-yl)piperazine-1-carboxylate?
(5-phenyl-2-pyridinyl) 4-(2-methylquinolin-4-yl)piperazine-1-carboxylate has a molecular weight of 424.50 g/mol, XLogP of 4.93, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-phenyl-2-pyridinyl) 4-(2-methylquinolin-4-yl)piperazine-1-carboxylate is sourced from PubChem (CID 53364507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).