About (6-chloro-1,2-benzoxazol-3-yl) piperidine-1-carboxylate
(6-chloro-1,2-benzoxazol-3-yl) piperidine-1-carboxylate (PubChem CID 53364513) has the molecular formula C13H13ClN2O3
and a molecular weight of 280.71 g/mol. Its IUPAC name is (6-chloro-1,2-benzoxazol-3-yl) piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (6-chloro-1,2-benzoxazol-3-yl) piperidine-1-carboxylate |
| PubChem CID | 53364513 |
| Molecular Formula | C13H13ClN2O3 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | (6-chloro-1,2-benzoxazol-3-yl) piperidine-1-carboxylate |
| SMILES | O=C(Oc1noc2cc(Cl)ccc12)N1CCCCC1 |
| InChI | InChI=1S/C13H13ClN2O3/c14-9-4-5-10-11(8-9)19-15-12(10)18-13(17)16-6-2-1-3-7-16/h4-5,8H,1-3,6-7H2 |
| InChIKey | OJIWUHZMNDGOGL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-chloro-1,2-benzoxazol-3-yl) piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-1,2-benzoxazol-3-yl) piperidine-1-carboxylate?
The IUPAC name of (6-chloro-1,2-benzoxazol-3-yl) piperidine-1-carboxylate (CID 53364513) is (6-chloro-1,2-benzoxazol-3-yl) piperidine-1-carboxylate.
What is the SMILES notation for (6-chloro-1,2-benzoxazol-3-yl) piperidine-1-carboxylate?
The canonical SMILES for (6-chloro-1,2-benzoxazol-3-yl) piperidine-1-carboxylate is O=C(Oc1noc2cc(Cl)ccc12)N1CCCCC1.
What is the InChIKey of (6-chloro-1,2-benzoxazol-3-yl) piperidine-1-carboxylate?
The InChIKey is OJIWUHZMNDGOGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClN2O3/c14-9-4-5-10-11(8-9)19-15-12(10)18-13(17)16-6-2-1-3-7-16/h4-5,8H,1-3,6-7H2.
What are the key properties of (6-chloro-1,2-benzoxazol-3-yl) piperidine-1-carboxylate?
(6-chloro-1,2-benzoxazol-3-yl) piperidine-1-carboxylate has a molecular weight of 280.71 g/mol, XLogP of 3.47, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-1,2-benzoxazol-3-yl) piperidine-1-carboxylate is sourced from PubChem (CID 53364513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).