About ethyl nona-2,3-dienoate
ethyl nona-2,3-dienoate (PubChem CID 533672) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is ethyl nona-2,3-dienoate.
Molecular Properties
| Compound Name | ethyl nona-2,3-dienoate |
| PubChem CID | 533672 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | ethyl nona-2,3-dienoate |
| SMILES | CCCCCC=C=CC(=O)OCC |
| InChI | InChI=1S/C11H18O2/c1-3-5-6-7-8-9-10-11(12)13-4-2/h8,10H,3-7H2,1-2H3 |
| InChIKey | RSGLOEHCQDOWGS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl nona-2,3-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl nona-2,3-dienoate?
The IUPAC name of ethyl nona-2,3-dienoate (CID 533672) is ethyl nona-2,3-dienoate.
What is the SMILES notation for ethyl nona-2,3-dienoate?
The canonical SMILES for ethyl nona-2,3-dienoate is CCCCCC=C=CC(=O)OCC.
What is the InChIKey of ethyl nona-2,3-dienoate?
The InChIKey is RSGLOEHCQDOWGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2/c1-3-5-6-7-8-9-10-11(12)13-4-2/h8,10H,3-7H2,1-2H3.
What are the key properties of ethyl nona-2,3-dienoate?
ethyl nona-2,3-dienoate has a molecular weight of 182.26 g/mol, XLogP of 2.84, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl nona-2,3-dienoate is sourced from PubChem (CID 533672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).