C23H21N5O5 — CID 53367203
2-[3-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-6-oxo-4,5-dihydropyridazin-1-yl]-N-(2,4-dimethylphenyl)acetamide (PubChem CID 53367203) has the molecular formula C23H21N5O5 and a molecular weight of 447.45 g/mol. Its IUPAC name is 2-[3-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-6-oxo-4,5-dihydropyridazin-1-yl]-N-(2,4-dimethylphenyl)acetamide.
| Compound Name | 2-[3-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-6-oxo-4,5-dihydropyridazin-1-yl]-N-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 53367203 |
| Molecular Formula | C23H21N5O5 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 2-[3-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-6-oxo-4,5-dihydropyridazin-1-yl]-N-(2,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2N=C(c3nc(-c4ccc5c(c4)OCO5)no3)CCC2=O)c(C)c1 |
| InChI | InChI=1S/C23H21N5O5/c1-13-3-5-16(14(2)9-13)24-20(29)11-28-21(30)8-6-17(26-28)23-25-22(27-33-23)15-4-7-18-19(10-15)32-12-31-18/h3-5,7,9-10H,6,8,11-12H2,1-2H3,(H,24,29) |
| InChIKey | PHOOHXDCRFIPBL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 119.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |