About ethyl 3-(2,4-dichlorophenyl)-3-[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]propanoate
ethyl 3-(2,4-dichlorophenyl)-3-[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]propanoate (PubChem CID 53367677) has the molecular formula C17H16Cl2O6
and a molecular weight of 387.22 g/mol. Its IUPAC name is ethyl 3-(2,4-dichlorophenyl)-3-[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]propanoate.
Molecular Properties
| Compound Name | ethyl 3-(2,4-dichlorophenyl)-3-[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]propanoate |
| PubChem CID | 53367677 |
| Molecular Formula | C17H16Cl2O6 |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | ethyl 3-(2,4-dichlorophenyl)-3-[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]propanoate |
| SMILES | CCOC(=O)CC(c1ccc(Cl)cc1Cl)c1oc(CO)cc(=O)c1O |
| InChI | InChI=1S/C17H16Cl2O6/c1-2-24-15(22)7-12(11-4-3-9(18)5-13(11)19)17-16(23)14(21)6-10(8-20)25-17/h3-6,12,20,23H,2,7-8H2,1H3 |
| InChIKey | NXWCFBWFBWTIRS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 3-(2,4-dichlorophenyl)-3-[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(2,4-dichlorophenyl)-3-[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]propanoate?
The IUPAC name of ethyl 3-(2,4-dichlorophenyl)-3-[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]propanoate (CID 53367677) is ethyl 3-(2,4-dichlorophenyl)-3-[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]propanoate.
What is the SMILES notation for ethyl 3-(2,4-dichlorophenyl)-3-[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]propanoate?
The canonical SMILES for ethyl 3-(2,4-dichlorophenyl)-3-[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]propanoate is CCOC(=O)CC(c1ccc(Cl)cc1Cl)c1oc(CO)cc(=O)c1O.
What is the InChIKey of ethyl 3-(2,4-dichlorophenyl)-3-[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]propanoate?
The InChIKey is NXWCFBWFBWTIRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16Cl2O6/c1-2-24-15(22)7-12(11-4-3-9(18)5-13(11)19)17-16(23)14(21)6-10(8-20)25-17/h3-6,12,20,23H,2,7-8H2,1H3.
What are the key properties of ethyl 3-(2,4-dichlorophenyl)-3-[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]propanoate?
ethyl 3-(2,4-dichlorophenyl)-3-[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]propanoate has a molecular weight of 387.22 g/mol, XLogP of 3.23, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(2,4-dichlorophenyl)-3-[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]propanoate is sourced from PubChem (CID 53367677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).