C18H20FN3O3 — CID 53368386
3-[4-(4-fluorophenyl)piperazin-1-yl]-4-morpholin-4-ylcyclobut-3-ene-1,2-dione (PubChem CID 53368386) has the molecular formula C18H20FN3O3 and a molecular weight of 345.37 g/mol. Its IUPAC name is 3-[4-(4-fluorophenyl)piperazin-1-yl]-4-morpholin-4-ylcyclobut-3-ene-1,2-dione.
| Compound Name | 3-[4-(4-fluorophenyl)piperazin-1-yl]-4-morpholin-4-ylcyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 53368386 |
| Molecular Formula | C18H20FN3O3 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 3-[4-(4-fluorophenyl)piperazin-1-yl]-4-morpholin-4-ylcyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(N2CCOCC2)c(N2CCN(c3ccc(F)cc3)CC2)c1=O |
| InChI | InChI=1S/C18H20FN3O3/c19-13-1-3-14(4-2-13)20-5-7-21(8-6-20)15-16(18(24)17(15)23)22-9-11-25-12-10-22/h1-4H,5-12H2 |
| InChIKey | JZYCMOUGKCPXNZ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|