C16H24N6O3 — CID 53368481
3-[2-hydroxy-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 53368481) has the molecular formula C16H24N6O3 and a molecular weight of 348.41 g/mol. Its IUPAC name is 3-[2-hydroxy-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[2-hydroxy-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 53368481 |
| Molecular Formula | C16H24N6O3 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 3-[2-hydroxy-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CC(O)CN2CCN(c3ncccn3)CC2)C1=O |
| InChI | InChI=1S/C16H24N6O3/c1-16(2)13(24)22(15(25)19-16)11-12(23)10-20-6-8-21(9-7-20)14-17-4-3-5-18-14/h3-5,12,23H,6-11H2,1-2H3,(H,19,25) |
| InChIKey | CHVZRNBQHKTYRU-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|