C14H21N3O3 — CID 53368580
N-(2-methoxyethyl)-2-(3-oxo-6,7,8,9-tetrahydro-5H-cyclohepta[c]pyridazin-2-yl)acetamide (PubChem CID 53368580) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-(3-oxo-6,7,8,9-tetrahydro-5H-cyclohepta[c]pyridazin-2-yl)acetamide.
| Compound Name | N-(2-methoxyethyl)-2-(3-oxo-6,7,8,9-tetrahydro-5H-cyclohepta[c]pyridazin-2-yl)acetamide |
|---|---|
| PubChem CID | 53368580 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N-(2-methoxyethyl)-2-(3-oxo-6,7,8,9-tetrahydro-5H-cyclohepta[c]pyridazin-2-yl)acetamide |
| SMILES | COCCNC(=O)Cn1nc2c(cc1=O)CCCCC2 |
| InChI | InChI=1S/C14H21N3O3/c1-20-8-7-15-13(18)10-17-14(19)9-11-5-3-2-4-6-12(11)16-17/h9H,2-8,10H2,1H3,(H,15,18) |
| InChIKey | NSYCUEYICXNGQF-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|