C18H21N3O4 — CID 53369280
1-cyclopentyl-4-(4-hydroxy-3-methoxyphenyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione (PubChem CID 53369280) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 1-cyclopentyl-4-(4-hydroxy-3-methoxyphenyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione.
| Compound Name | 1-cyclopentyl-4-(4-hydroxy-3-methoxyphenyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione |
|---|---|
| PubChem CID | 53369280 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 1-cyclopentyl-4-(4-hydroxy-3-methoxyphenyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione |
| SMILES | COc1cc(C2CC(=O)Nc3c2c(=O)[nH]n3C2CCCC2)ccc1O |
| InChI | InChI=1S/C18H21N3O4/c1-25-14-8-10(6-7-13(14)22)12-9-15(23)19-17-16(12)18(24)20-21(17)11-4-2-3-5-11/h6-8,11-12,22H,2-5,9H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | AJCZPSZVOZTGMI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |