C15H12ClN5OS — CID 53369307
4-[[3-(4-chlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]methyl]-3,5-dimethyl-1,2-oxazole (PubChem CID 53369307) has the molecular formula C15H12ClN5OS and a molecular weight of 345.82 g/mol. Its IUPAC name is 4-[[3-(4-chlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]methyl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[[3-(4-chlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]methyl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 53369307 |
| Molecular Formula | C15H12ClN5OS |
| Molecular Weight | 345.82 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 4-[[3-(4-chlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]methyl]-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1Cc1nn2c(-c3ccc(Cl)cc3)nnc2s1 |
| InChI | InChI=1S/C15H12ClN5OS/c1-8-12(9(2)22-20-8)7-13-19-21-14(17-18-15(21)23-13)10-3-5-11(16)6-4-10/h3-6H,7H2,1-2H3 |
| InChIKey | LBWHHUSDNKYIIJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 69.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.82 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |