About 1-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)indole-3-carboxamide
1-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)indole-3-carboxamide (PubChem CID 53370102) has the molecular formula C16H16N4OS
and a molecular weight of 312.40 g/mol. Its IUPAC name is 1-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)indole-3-carboxamide.
Molecular Properties
| Compound Name | 1-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)indole-3-carboxamide |
| PubChem CID | 53370102 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 1-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)indole-3-carboxamide |
| SMILES | Cn1nc2c(c1NC(=O)c1cn(C)c3ccccc13)CSC2 |
| InChI | InChI=1S/C16H16N4OS/c1-19-7-11(10-5-3-4-6-14(10)19)16(21)17-15-12-8-22-9-13(12)18-20(15)2/h3-7H,8-9H2,1-2H3,(H,17,21) |
| InChIKey | VTYZRTNKLMJPCX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)indole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)indole-3-carboxamide?
The IUPAC name of 1-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)indole-3-carboxamide (CID 53370102) is 1-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)indole-3-carboxamide.
What is the SMILES notation for 1-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)indole-3-carboxamide?
The canonical SMILES for 1-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)indole-3-carboxamide is Cn1nc2c(c1NC(=O)c1cn(C)c3ccccc13)CSC2.
What is the InChIKey of 1-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)indole-3-carboxamide?
The InChIKey is VTYZRTNKLMJPCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4OS/c1-19-7-11(10-5-3-4-6-14(10)19)16(21)17-15-12-8-22-9-13(12)18-20(15)2/h3-7H,8-9H2,1-2H3,(H,17,21).
What are the key properties of 1-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)indole-3-carboxamide?
1-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)indole-3-carboxamide has a molecular weight of 312.40 g/mol, XLogP of 2.91, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N-(2-methyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)indole-3-carboxamide is sourced from PubChem (CID 53370102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).