About 3-benzyl-1-[3-(dimethylamino)propyl]-6,7-dimethoxyquinazoline-2,4-dione
3-benzyl-1-[3-(dimethylamino)propyl]-6,7-dimethoxyquinazoline-2,4-dione (PubChem CID 53370466) has the molecular formula C22H27N3O4
and a molecular weight of 397.48 g/mol. Its IUPAC name is 3-benzyl-1-[3-(dimethylamino)propyl]-6,7-dimethoxyquinazoline-2,4-dione.
Molecular Properties
| Compound Name | 3-benzyl-1-[3-(dimethylamino)propyl]-6,7-dimethoxyquinazoline-2,4-dione |
| PubChem CID | 53370466 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 3-benzyl-1-[3-(dimethylamino)propyl]-6,7-dimethoxyquinazoline-2,4-dione |
| SMILES | COc1cc2c(=O)n(Cc3ccccc3)c(=O)n(CCCN(C)C)c2cc1OC |
| InChI | InChI=1S/C22H27N3O4/c1-23(2)11-8-12-24-18-14-20(29-4)19(28-3)13-17(18)21(26)25(22(24)27)15-16-9-6-5-7-10-16/h5-7,9-10,13-14H,8,11-12,15H2,1-4H3 |
| InChIKey | IRODVQHHHLUUAA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 65.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-benzyl-1-[3-(dimethylamino)propyl]-6,7-dimethoxyquinazoline-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-1-[3-(dimethylamino)propyl]-6,7-dimethoxyquinazoline-2,4-dione?
The IUPAC name of 3-benzyl-1-[3-(dimethylamino)propyl]-6,7-dimethoxyquinazoline-2,4-dione (CID 53370466) is 3-benzyl-1-[3-(dimethylamino)propyl]-6,7-dimethoxyquinazoline-2,4-dione.
What is the SMILES notation for 3-benzyl-1-[3-(dimethylamino)propyl]-6,7-dimethoxyquinazoline-2,4-dione?
The canonical SMILES for 3-benzyl-1-[3-(dimethylamino)propyl]-6,7-dimethoxyquinazoline-2,4-dione is COc1cc2c(=O)n(Cc3ccccc3)c(=O)n(CCCN(C)C)c2cc1OC.
What is the InChIKey of 3-benzyl-1-[3-(dimethylamino)propyl]-6,7-dimethoxyquinazoline-2,4-dione?
The InChIKey is IRODVQHHHLUUAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N3O4/c1-23(2)11-8-12-24-18-14-20(29-4)19(28-3)13-17(18)21(26)25(22(24)27)15-16-9-6-5-7-10-16/h5-7,9-10,13-14H,8,11-12,15H2,1-4H3.
What are the key properties of 3-benzyl-1-[3-(dimethylamino)propyl]-6,7-dimethoxyquinazoline-2,4-dione?
3-benzyl-1-[3-(dimethylamino)propyl]-6,7-dimethoxyquinazoline-2,4-dione has a molecular weight of 397.48 g/mol, XLogP of 2.18, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-1-[3-(dimethylamino)propyl]-6,7-dimethoxyquinazoline-2,4-dione is sourced from PubChem (CID 53370466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).