C21H24FN5O3 — CID 53371058
N-[1-(4-carbamoylanilino)-1-oxopropan-2-yl]-4-(4-fluorophenyl)piperazine-1-carboxamide (PubChem CID 53371058) has the molecular formula C21H24FN5O3 and a molecular weight of 413.45 g/mol. Its IUPAC name is N-[1-(4-carbamoylanilino)-1-oxopropan-2-yl]-4-(4-fluorophenyl)piperazine-1-carboxamide.
| Compound Name | N-[1-(4-carbamoylanilino)-1-oxopropan-2-yl]-4-(4-fluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 53371058 |
| Molecular Formula | C21H24FN5O3 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N-[1-(4-carbamoylanilino)-1-oxopropan-2-yl]-4-(4-fluorophenyl)piperazine-1-carboxamide |
| SMILES | CC(NC(=O)N1CCN(c2ccc(F)cc2)CC1)C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C21H24FN5O3/c1-14(20(29)25-17-6-2-15(3-7-17)19(23)28)24-21(30)27-12-10-26(11-13-27)18-8-4-16(22)5-9-18/h2-9,14H,10-13H2,1H3,(H2,23,28)(H,24,30)(H,25,29) |
| InChIKey | HVXFCMLPGOVJLK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |