C16H20N4O3 — CID 53371065
2-[[3,4-dioxo-2-(pyridin-4-ylmethylamino)cyclobuten-1-yl]amino]-N-(2-methylpropyl)acetamide (PubChem CID 53371065) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-[[3,4-dioxo-2-(pyridin-4-ylmethylamino)cyclobuten-1-yl]amino]-N-(2-methylpropyl)acetamide.
| Compound Name | 2-[[3,4-dioxo-2-(pyridin-4-ylmethylamino)cyclobuten-1-yl]amino]-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 53371065 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 2-[[3,4-dioxo-2-(pyridin-4-ylmethylamino)cyclobuten-1-yl]amino]-N-(2-methylpropyl)acetamide |
| SMILES | CC(C)CNC(=O)CNc1c(NCc2ccncc2)c(=O)c1=O |
| InChI | InChI=1S/C16H20N4O3/c1-10(2)7-18-12(21)9-20-14-13(15(22)16(14)23)19-8-11-3-5-17-6-4-11/h3-6,10,19-20H,7-9H2,1-2H3,(H,18,21) |
| InChIKey | WVUBOFMZPIOUCB-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|