C19H23N3O4 — CID 53371186
1-cyclohexyl-4-(4-hydroxy-3-methoxyphenyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione (PubChem CID 53371186) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-cyclohexyl-4-(4-hydroxy-3-methoxyphenyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione.
| Compound Name | 1-cyclohexyl-4-(4-hydroxy-3-methoxyphenyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione |
|---|---|
| PubChem CID | 53371186 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 1-cyclohexyl-4-(4-hydroxy-3-methoxyphenyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione |
| SMILES | COc1cc(C2CC(=O)Nc3c2c(=O)[nH]n3C2CCCCC2)ccc1O |
| InChI | InChI=1S/C19H23N3O4/c1-26-15-9-11(7-8-14(15)23)13-10-16(24)20-18-17(13)19(25)21-22(18)12-5-3-2-4-6-12/h7-9,12-13,23H,2-6,10H2,1H3,(H,20,24)(H,21,25) |
| InChIKey | LZEJMOMYZAIXQP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |