About 5-O-ethyl 1-O-methyl pentanedioate
5-O-ethyl 1-O-methyl pentanedioate (PubChem CID 533712) has the molecular formula C8H14O4
and a molecular weight of 174.20 g/mol. Its IUPAC name is 5-O-ethyl 1-O-methyl pentanedioate.
Molecular Properties
| Compound Name | 5-O-ethyl 1-O-methyl pentanedioate |
| PubChem CID | 533712 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 5-O-ethyl 1-O-methyl pentanedioate |
| SMILES | CCOC(=O)CCCC(=O)OC |
| InChI | InChI=1S/C8H14O4/c1-3-12-8(10)6-4-5-7(9)11-2/h3-6H2,1-2H3 |
| InChIKey | YHRUNAIXGSNSTP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-O-ethyl 1-O-methyl pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-ethyl 1-O-methyl pentanedioate?
The IUPAC name of 5-O-ethyl 1-O-methyl pentanedioate (CID 533712) is 5-O-ethyl 1-O-methyl pentanedioate.
What is the SMILES notation for 5-O-ethyl 1-O-methyl pentanedioate?
The canonical SMILES for 5-O-ethyl 1-O-methyl pentanedioate is CCOC(=O)CCCC(=O)OC.
What is the InChIKey of 5-O-ethyl 1-O-methyl pentanedioate?
The InChIKey is YHRUNAIXGSNSTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4/c1-3-12-8(10)6-4-5-7(9)11-2/h3-6H2,1-2H3.
What are the key properties of 5-O-ethyl 1-O-methyl pentanedioate?
5-O-ethyl 1-O-methyl pentanedioate has a molecular weight of 174.20 g/mol, XLogP of 0.89, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-ethyl 1-O-methyl pentanedioate is sourced from PubChem (CID 533712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).