C22H18ClFN4O2 — CID 53371539
2-(5-chloro-2-fluorophenyl)-N-[3-(2-methoxyethoxy)-4-pyridinyl]-1,8-naphthyridin-4-amine (PubChem CID 53371539) has the molecular formula C22H18ClFN4O2 and a molecular weight of 424.86 g/mol. Its IUPAC name is 2-(5-chloro-2-fluorophenyl)-N-[3-(2-methoxyethoxy)-4-pyridinyl]-1,8-naphthyridin-4-amine.
| Compound Name | 2-(5-chloro-2-fluorophenyl)-N-[3-(2-methoxyethoxy)-4-pyridinyl]-1,8-naphthyridin-4-amine |
|---|---|
| PubChem CID | 53371539 |
| Molecular Formula | C22H18ClFN4O2 |
| Molecular Weight | 424.86 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 2-(5-chloro-2-fluorophenyl)-N-[3-(2-methoxyethoxy)-4-pyridinyl]-1,8-naphthyridin-4-amine |
| SMILES | COCCOc1cnccc1Nc1cc(-c2cc(Cl)ccc2F)nc2ncccc12 |
| InChI | InChI=1S/C22H18ClFN4O2/c1-29-9-10-30-21-13-25-8-6-18(21)27-19-12-20(16-11-14(23)4-5-17(16)24)28-22-15(19)3-2-7-26-22/h2-8,11-13H,9-10H2,1H3,(H,25,26,27,28) |
| InChIKey | BQHORJDIGSXYPR-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.86 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|