C21H21F3N6O3 — CID 53371553
N-methyl-3-[[4-[3-[4-(trifluoromethoxy)phenoxy]propylamino]-1,3,5-triazin-2-yl]amino]benzamide (PubChem CID 53371553) has the molecular formula C21H21F3N6O3 and a molecular weight of 462.43 g/mol. Its IUPAC name is N-methyl-3-[[4-[3-[4-(trifluoromethoxy)phenoxy]propylamino]-1,3,5-triazin-2-yl]amino]benzamide.
| Compound Name | N-methyl-3-[[4-[3-[4-(trifluoromethoxy)phenoxy]propylamino]-1,3,5-triazin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 53371553 |
| Molecular Formula | C21H21F3N6O3 |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | N-methyl-3-[[4-[3-[4-(trifluoromethoxy)phenoxy]propylamino]-1,3,5-triazin-2-yl]amino]benzamide |
| SMILES | CNC(=O)c1cccc(Nc2ncnc(NCCCOc3ccc(OC(F)(F)F)cc3)n2)c1 |
| InChI | InChI=1S/C21H21F3N6O3/c1-25-18(31)14-4-2-5-15(12-14)29-20-28-13-27-19(30-20)26-10-3-11-32-16-6-8-17(9-7-16)33-21(22,23)24/h2,4-9,12-13H,3,10-11H2,1H3,(H,25,31)(H2,26,27,28,29,30) |
| InChIKey | JWLGBWPHXUGIOT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|