C21H25N5 — CID 53371586
10,14-dimethyl-12-(2-pyrazin-2-ylethyl)-6,10,13-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraene (PubChem CID 53371586) has the molecular formula C21H25N5 and a molecular weight of 347.47 g/mol. Its IUPAC name is 10,14-dimethyl-12-(2-pyrazin-2-ylethyl)-6,10,13-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraene.
| Compound Name | 10,14-dimethyl-12-(2-pyrazin-2-ylethyl)-6,10,13-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraene |
|---|---|
| PubChem CID | 53371586 |
| Molecular Formula | C21H25N5 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 10,14-dimethyl-12-(2-pyrazin-2-ylethyl)-6,10,13-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraene |
| SMILES | Cc1cc2c3c(n(C)c2c(CCc2cnccn2)n1)CCN1CCCC31 |
| InChI | InChI=1S/C21H25N5/c1-14-12-16-20-18(7-11-26-10-3-4-19(20)26)25(2)21(16)17(24-14)6-5-15-13-22-8-9-23-15/h8-9,12-13,19H,3-7,10-11H2,1-2H3 |
| InChIKey | ARBGSSXZMRDFAO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |