C22H26ClN3O — CID 53371726
1-(9-chloro-3,6-dimethyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-7-yl)-2-pyridin-3-ylpropan-2-ol (PubChem CID 53371726) has the molecular formula C22H26ClN3O and a molecular weight of 383.92 g/mol. Its IUPAC name is 1-(9-chloro-3,6-dimethyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-7-yl)-2-pyridin-3-ylpropan-2-ol.
| Compound Name | 1-(9-chloro-3,6-dimethyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-7-yl)-2-pyridin-3-ylpropan-2-ol |
|---|---|
| PubChem CID | 53371726 |
| Molecular Formula | C22H26ClN3O |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 1-(9-chloro-3,6-dimethyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-7-yl)-2-pyridin-3-ylpropan-2-ol |
| SMILES | CN1CCc2c(n(C)c3c(CC(C)(O)c4cccnc4)cc(Cl)cc23)CC1 |
| InChI | InChI=1S/C22H26ClN3O/c1-22(27,16-5-4-8-24-14-16)13-15-11-17(23)12-19-18-6-9-25(2)10-7-20(18)26(3)21(15)19/h4-5,8,11-12,14,27H,6-7,9-10,13H2,1-3H3 |
| InChIKey | WFVWGWPTZVECEE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|