C22H25N7O — CID 53371945
N-methyl-3-[[4-[4-(4-methylphenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]benzamide (PubChem CID 53371945) has the molecular formula C22H25N7O and a molecular weight of 403.49 g/mol. Its IUPAC name is N-methyl-3-[[4-[4-(4-methylphenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]benzamide.
| Compound Name | N-methyl-3-[[4-[4-(4-methylphenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 53371945 |
| Molecular Formula | C22H25N7O |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | N-methyl-3-[[4-[4-(4-methylphenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]benzamide |
| SMILES | CNC(=O)c1cccc(Nc2ncnc(N3CCN(c4ccc(C)cc4)CC3)n2)c1 |
| InChI | InChI=1S/C22H25N7O/c1-16-6-8-19(9-7-16)28-10-12-29(13-11-28)22-25-15-24-21(27-22)26-18-5-3-4-17(14-18)20(30)23-2/h3-9,14-15H,10-13H2,1-2H3,(H,23,30)(H,24,25,26,27) |
| InChIKey | FNVMRZDSIRYBBD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|