C22H23FN6O3 — CID 53371949
3-[[4-[3-(4-fluorophenoxy)azetidin-1-yl]-1,3,5-triazin-2-yl]amino]-N-(2-methoxyethyl)benzamide (PubChem CID 53371949) has the molecular formula C22H23FN6O3 and a molecular weight of 438.46 g/mol. Its IUPAC name is 3-[[4-[3-(4-fluorophenoxy)azetidin-1-yl]-1,3,5-triazin-2-yl]amino]-N-(2-methoxyethyl)benzamide.
| Compound Name | 3-[[4-[3-(4-fluorophenoxy)azetidin-1-yl]-1,3,5-triazin-2-yl]amino]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 53371949 |
| Molecular Formula | C22H23FN6O3 |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 3-[[4-[3-(4-fluorophenoxy)azetidin-1-yl]-1,3,5-triazin-2-yl]amino]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1cccc(Nc2ncnc(N3CC(Oc4ccc(F)cc4)C3)n2)c1 |
| InChI | InChI=1S/C22H23FN6O3/c1-31-10-9-24-20(30)15-3-2-4-17(11-15)27-21-25-14-26-22(28-21)29-12-19(13-29)32-18-7-5-16(23)6-8-18/h2-8,11,14,19H,9-10,12-13H2,1H3,(H,24,30)(H,25,26,27,28) |
| InChIKey | XSDCFDIHEIBQJJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|